C24H20BrCl3N2O3S — CID 126144617
N-[(Z)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide (PubChem CID 126144617) has the molecular formula C24H20BrCl3N2O3S and a molecular weight of 602.77 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(Z)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 126144617 |
| Molecular Formula | C24H20BrCl3N2O3S |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 599.94 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CSCc2c(Cl)cccc2Cl)cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H20BrCl3N2O3S/c1-32-22-10-16(9-19(25)24(22)33-12-15-5-7-17(26)8-6-15)11-29-30-23(31)14-34-13-18-20(27)3-2-4-21(18)28/h2-11H,12-14H2,1H3,(H,30,31)/b29-11- |
| InChIKey | ZYMFCEJUVMOMFE-KYMQWJLESA-N |
| XLogP | 7.38 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|