C18H17BrCl2N2O3S — CID 137130995
N-[(Z)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide (PubChem CID 137130995) has the molecular formula C18H17BrCl2N2O3S and a molecular weight of 492.22 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(Z)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 137130995 |
| Molecular Formula | C18H17BrCl2N2O3S |
| Molecular Weight | 492.22 g/mol |
| Exact Mass | 489.95 |
| IUPAC Name | N-[(Z)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CSCc2c(Cl)cccc2Cl)cc(Br)c1O |
| InChI | InChI=1S/C18H17BrCl2N2O3S/c1-2-26-16-7-11(6-13(19)18(16)25)8-22-23-17(24)10-27-9-12-14(20)4-3-5-15(12)21/h3-8,25H,2,9-10H2,1H3,(H,23,24)/b22-8- |
| InChIKey | VRTVRZFBVSEHPH-UYOCIXKTSA-N |
| XLogP | 5.24 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.22 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|