C17H14BrCl2N3O4 — CID 135554219
N'-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-N-(2,3-dichlorophenyl)oxamide (PubChem CID 135554219) has the molecular formula C17H14BrCl2N3O4 and a molecular weight of 475.13 g/mol. Its IUPAC name is N'-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-N-(2,3-dichlorophenyl)oxamide.
| Compound Name | N'-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-N-(2,3-dichlorophenyl)oxamide |
|---|---|
| PubChem CID | 135554219 |
| Molecular Formula | C17H14BrCl2N3O4 |
| Molecular Weight | 475.13 g/mol |
| Exact Mass | 472.95 |
| IUPAC Name | N'-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-N-(2,3-dichlorophenyl)oxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)C(=O)Nc2cccc(Cl)c2Cl)cc(Br)c1O |
| InChI | InChI=1S/C17H14BrCl2N3O4/c1-2-27-13-7-9(6-10(18)15(13)24)8-21-23-17(26)16(25)22-12-5-3-4-11(19)14(12)20/h3-8,24H,2H2,1H3,(H,22,25)(H,23,26)/b21-8+ |
| InChIKey | ITXGDIFCOZZFQY-ODCIPOBUSA-N |
| XLogP | 3.95 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.13 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|