C24H19BrCl2FN3O4 — CID 4255689
N'-[[3-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-N-(2-fluorophenyl)oxamide (PubChem CID 4255689) has the molecular formula C24H19BrCl2FN3O4 and a molecular weight of 583.24 g/mol. Its IUPAC name is N'-[[3-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-N-(2-fluorophenyl)oxamide.
| Compound Name | N'-[[3-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-N-(2-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 4255689 |
| Molecular Formula | C24H19BrCl2FN3O4 |
| Molecular Weight | 583.24 g/mol |
| Exact Mass | 580.99 |
| IUPAC Name | N'-[[3-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-N-(2-fluorophenyl)oxamide |
| SMILES | CCOc1cc(C=NNC(=O)C(=O)Nc2ccccc2F)cc(Br)c1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H19BrCl2FN3O4/c1-2-34-21-11-14(10-16(25)22(21)35-13-15-17(26)6-5-7-18(15)27)12-29-31-24(33)23(32)30-20-9-4-3-8-19(20)28/h3-12H,2,13H2,1H3,(H,30,32)(H,31,33) |
| InChIKey | HLAXUGJJGNPCJA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.24 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|