C23H24BrFN4O6 — CID 126163140
N'-[(Z)-[3-bromo-5-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-N-(2-fluorophenyl)oxamide (PubChem CID 126163140) has the molecular formula C23H24BrFN4O6 and a molecular weight of 551.37 g/mol. Its IUPAC name is N'-[(Z)-[3-bromo-5-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-N-(2-fluorophenyl)oxamide.
| Compound Name | N'-[(Z)-[3-bromo-5-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-N-(2-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 126163140 |
| Molecular Formula | C23H24BrFN4O6 |
| Molecular Weight | 551.37 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | N'-[(Z)-[3-bromo-5-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-N-(2-fluorophenyl)oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)Nc2ccccc2F)cc(Br)c1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C23H24BrFN4O6/c1-2-34-19-12-15(11-16(24)21(19)35-14-20(30)29-7-9-33-10-8-29)13-26-28-23(32)22(31)27-18-6-4-3-5-17(18)25/h3-6,11-13H,2,7-10,14H2,1H3,(H,27,31)(H,28,32)/b26-13- |
| InChIKey | OMMAIIPDTBKCPS-ZMFRSBBQSA-N |
| XLogP | 2.31 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|