C26H31BrN4O7 — CID 126169448
N'-[(Z)-[3-bromo-5-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-N-(4-propoxyphenyl)oxamide (PubChem CID 126169448) has the molecular formula C26H31BrN4O7 and a molecular weight of 591.46 g/mol. Its IUPAC name is N'-[(Z)-[3-bromo-5-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-N-(4-propoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[3-bromo-5-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-N-(4-propoxyphenyl)oxamide |
|---|---|
| PubChem CID | 126169448 |
| Molecular Formula | C26H31BrN4O7 |
| Molecular Weight | 591.46 g/mol |
| Exact Mass | 590.14 |
| IUPAC Name | N'-[(Z)-[3-bromo-5-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-N-(4-propoxyphenyl)oxamide |
| SMILES | CCCOc1ccc(NC(=O)C(=O)N/N=C\c2cc(Br)c(OCC(=O)N3CCOCC3)c(OCC)c2)cc1 |
| InChI | InChI=1S/C26H31BrN4O7/c1-3-11-37-20-7-5-19(6-8-20)29-25(33)26(34)30-28-16-18-14-21(27)24(22(15-18)36-4-2)38-17-23(32)31-9-12-35-13-10-31/h5-8,14-16H,3-4,9-13,17H2,1-2H3,(H,29,33)(H,30,34)/b28-16- |
| InChIKey | MUDGKISNSISDTQ-NTFVMDSBSA-N |
| XLogP | 2.96 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|