C28H29BrN4O6 — CID 126172893
N'-[(Z)-[3-bromo-4-[2-(3,5-dimethylanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-N-(4-methoxyphenyl)oxamide (PubChem CID 126172893) has the molecular formula C28H29BrN4O6 and a molecular weight of 597.47 g/mol. Its IUPAC name is N'-[(Z)-[3-bromo-4-[2-(3,5-dimethylanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-N-(4-methoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[3-bromo-4-[2-(3,5-dimethylanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-N-(4-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 126172893 |
| Molecular Formula | C28H29BrN4O6 |
| Molecular Weight | 597.47 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | N'-[(Z)-[3-bromo-4-[2-(3,5-dimethylanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-N-(4-methoxyphenyl)oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)Nc2ccc(OC)cc2)cc(Br)c1OCC(=O)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C28H29BrN4O6/c1-5-38-24-14-19(15-30-33-28(36)27(35)32-20-6-8-22(37-4)9-7-20)13-23(29)26(24)39-16-25(34)31-21-11-17(2)10-18(3)12-21/h6-15H,5,16H2,1-4H3,(H,31,34)(H,32,35)(H,33,36)/b30-15- |
| InChIKey | FSQRSSDMPMLTAT-MNDYBZJGSA-N |
| XLogP | 4.58 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|