C30H33BrN4O6 — CID 126175727
N'-[(Z)-[3-bromo-5-ethoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]-N-[(4-methoxyphenyl)methyl]oxamide (PubChem CID 126175727) has the molecular formula C30H33BrN4O6 and a molecular weight of 625.52 g/mol. Its IUPAC name is N'-[(Z)-[3-bromo-5-ethoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]-N-[(4-methoxyphenyl)methyl]oxamide.
| Compound Name | N'-[(Z)-[3-bromo-5-ethoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]-N-[(4-methoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 126175727 |
| Molecular Formula | C30H33BrN4O6 |
| Molecular Weight | 625.52 g/mol |
| Exact Mass | 624.16 |
| IUPAC Name | N'-[(Z)-[3-bromo-5-ethoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]-N-[(4-methoxyphenyl)methyl]oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)NCc2ccc(OC)cc2)cc(Br)c1OCC(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C30H33BrN4O6/c1-6-40-25-14-22(16-33-35-30(38)29(37)32-15-21-7-9-23(39-5)10-8-21)13-24(31)28(25)41-17-26(36)34-27-19(3)11-18(2)12-20(27)4/h7-14,16H,6,15,17H2,1-5H3,(H,32,37)(H,34,36)(H,35,38)/b33-16- |
| InChIKey | PRBNJISPJSHYTN-BJUCDSOZSA-N |
| XLogP | 4.57 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|