C26H33BrN4O5 — CID 126165444
N'-[(Z)-[3-bromo-5-ethoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]-N-[(2S)-butan-2-yl]oxamide (PubChem CID 126165444) has the molecular formula C26H33BrN4O5 and a molecular weight of 561.48 g/mol. Its IUPAC name is N'-[(Z)-[3-bromo-5-ethoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]-N-[(2S)-butan-2-yl]oxamide.
| Compound Name | N'-[(Z)-[3-bromo-5-ethoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]-N-[(2S)-butan-2-yl]oxamide |
|---|---|
| PubChem CID | 126165444 |
| Molecular Formula | C26H33BrN4O5 |
| Molecular Weight | 561.48 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | N'-[(Z)-[3-bromo-5-ethoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]-N-[(2S)-butan-2-yl]oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)N[C@@H](C)CC)cc(Br)c1OCC(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C26H33BrN4O5/c1-7-18(6)29-25(33)26(34)31-28-13-19-11-20(27)24(21(12-19)35-8-2)36-14-22(32)30-23-16(4)9-15(3)10-17(23)5/h9-13,18H,7-8,14H2,1-6H3,(H,29,33)(H,30,32)(H,31,34)/b28-13-/t18-/m0/s1 |
| InChIKey | ZHQNUMYZXIRADG-DDAUFPHHSA-N |
| XLogP | 4.16 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|