C22H23BrCl2N4O5 — CID 126160602
N'-[(Z)-[3-bromo-4-[2-(2,3-dichloroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-[(2S)-butan-2-yl]oxamide (PubChem CID 126160602) has the molecular formula C22H23BrCl2N4O5 and a molecular weight of 574.26 g/mol. Its IUPAC name is N'-[(Z)-[3-bromo-4-[2-(2,3-dichloroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-[(2S)-butan-2-yl]oxamide.
| Compound Name | N'-[(Z)-[3-bromo-4-[2-(2,3-dichloroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-[(2S)-butan-2-yl]oxamide |
|---|---|
| PubChem CID | 126160602 |
| Molecular Formula | C22H23BrCl2N4O5 |
| Molecular Weight | 574.26 g/mol |
| Exact Mass | 572.02 |
| IUPAC Name | N'-[(Z)-[3-bromo-4-[2-(2,3-dichloroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-[(2S)-butan-2-yl]oxamide |
| SMILES | CC[C@H](C)NC(=O)C(=O)N/N=C\c1cc(Br)c(OCC(=O)Nc2cccc(Cl)c2Cl)c(OC)c1 |
| InChI | InChI=1S/C22H23BrCl2N4O5/c1-4-12(2)27-21(31)22(32)29-26-10-13-8-14(23)20(17(9-13)33-3)34-11-18(30)28-16-7-5-6-15(24)19(16)25/h5-10,12H,4,11H2,1-3H3,(H,27,31)(H,28,30)(H,29,32)/b26-10-/t12-/m0/s1 |
| InChIKey | GRQGGOSSEBOOBF-MZHZBVLSSA-N |
| XLogP | 4.15 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.26 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|