C23H26Cl2N4O5 — CID 126262313
N-[(2S)-butan-2-yl]-N'-[(Z)-[3-chloro-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]oxamide (PubChem CID 126262313) has the molecular formula C23H26Cl2N4O5 and a molecular weight of 509.39 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-N'-[(Z)-[3-chloro-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]oxamide.
| Compound Name | N-[(2S)-butan-2-yl]-N'-[(Z)-[3-chloro-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126262313 |
| Molecular Formula | C23H26Cl2N4O5 |
| Molecular Weight | 509.39 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | N-[(2S)-butan-2-yl]-N'-[(Z)-[3-chloro-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]oxamide |
| SMILES | CC[C@H](C)NC(=O)C(=O)N/N=C\c1cc(Cl)c(OCC(=O)Nc2ccc(C)c(Cl)c2)c(OC)c1 |
| InChI | InChI=1S/C23H26Cl2N4O5/c1-5-14(3)27-22(31)23(32)29-26-11-15-8-18(25)21(19(9-15)33-4)34-12-20(30)28-16-7-6-13(2)17(24)10-16/h6-11,14H,5,12H2,1-4H3,(H,27,31)(H,28,30)(H,29,32)/b26-11-/t14-/m0/s1 |
| InChIKey | KEAYAKLCWHVEHP-MIMRRFGUSA-N |
| XLogP | 3.69 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|