C25H31IN4O5 — CID 126164981
N-[(2R)-butan-2-yl]-N'-[(Z)-[3-iodo-5-methoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]oxamide (PubChem CID 126164981) has the molecular formula C25H31IN4O5 and a molecular weight of 594.45 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-N'-[(Z)-[3-iodo-5-methoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-[(2R)-butan-2-yl]-N'-[(Z)-[3-iodo-5-methoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126164981 |
| Molecular Formula | C25H31IN4O5 |
| Molecular Weight | 594.45 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | N-[(2R)-butan-2-yl]-N'-[(Z)-[3-iodo-5-methoxy-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]oxamide |
| SMILES | CC[C@@H](C)NC(=O)C(=O)N/N=C\c1cc(I)c(OCC(=O)Nc2c(C)cc(C)cc2C)c(OC)c1 |
| InChI | InChI=1S/C25H31IN4O5/c1-7-17(5)28-24(32)25(33)30-27-12-18-10-19(26)23(20(11-18)34-6)35-13-21(31)29-22-15(3)8-14(2)9-16(22)4/h8-12,17H,7,13H2,1-6H3,(H,28,32)(H,29,31)(H,30,33)/b27-12-/t17-/m1/s1 |
| InChIKey | YGVTWOLVCIXCTF-DXOYIPFMSA-N |
| XLogP | 3.61 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|