C25H31BrN4O5 — CID 126159676
N'-[(Z)-[4-[2-(4-bromo-2,6-dimethylanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-[(2S)-butan-2-yl]oxamide (PubChem CID 126159676) has the molecular formula C25H31BrN4O5 and a molecular weight of 547.45 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(4-bromo-2,6-dimethylanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-[(2S)-butan-2-yl]oxamide.
| Compound Name | N'-[(Z)-[4-[2-(4-bromo-2,6-dimethylanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-[(2S)-butan-2-yl]oxamide |
|---|---|
| PubChem CID | 126159676 |
| Molecular Formula | C25H31BrN4O5 |
| Molecular Weight | 547.45 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | N'-[(Z)-[4-[2-(4-bromo-2,6-dimethylanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-[(2S)-butan-2-yl]oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)N[C@@H](C)CC)ccc1OCC(=O)Nc1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C25H31BrN4O5/c1-6-17(5)28-24(32)25(33)30-27-13-18-8-9-20(21(12-18)34-7-2)35-14-22(31)29-23-15(3)10-19(26)11-16(23)4/h8-13,17H,6-7,14H2,1-5H3,(H,28,32)(H,29,31)(H,30,33)/b27-13-/t17-/m0/s1 |
| InChIKey | LOEORWVSLUFTSJ-WARZPUNJSA-N |
| XLogP | 3.85 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|