C23H29N3O4 — CID 8902430
N-[(2S)-butan-2-yl]-N'-[(Z)-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]oxamide (PubChem CID 8902430) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-N'-[(Z)-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-[(2S)-butan-2-yl]-N'-[(Z)-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 8902430 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | N-[(2S)-butan-2-yl]-N'-[(Z)-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)N[C@@H](C)CC)ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C23H29N3O4/c1-5-17(4)25-22(27)23(28)26-24-14-19-11-12-20(21(13-19)29-6-2)30-15-18-9-7-16(3)8-10-18/h7-14,17H,5-6,15H2,1-4H3,(H,25,27)(H,26,28)/b24-14-/t17-/m0/s1 |
| InChIKey | JJMWSNMZSJIGTN-PDESAOGPSA-N |
| XLogP | 3.34 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|