C26H26ClN3O4 — CID 3371098
N'-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(2,5-dimethylphenyl)oxamide (PubChem CID 3371098) has the molecular formula C26H26ClN3O4 and a molecular weight of 479.96 g/mol. Its IUPAC name is N'-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(2,5-dimethylphenyl)oxamide.
| Compound Name | N'-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(2,5-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 3371098 |
| Molecular Formula | C26H26ClN3O4 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | N'-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(2,5-dimethylphenyl)oxamide |
| SMILES | CCOc1cc(C=NNC(=O)C(=O)Nc2cc(C)ccc2C)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H26ClN3O4/c1-4-33-24-14-20(9-12-23(24)34-16-19-7-10-21(27)11-8-19)15-28-30-26(32)25(31)29-22-13-17(2)5-6-18(22)3/h5-15H,4,16H2,1-3H3,(H,29,31)(H,30,32) |
| InChIKey | YFCRCWVAIDZINK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|