C28H30BrN3O4 — CID 4006167
N'-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(2,5-dimethylphenyl)butanediamide (PubChem CID 4006167) has the molecular formula C28H30BrN3O4 and a molecular weight of 552.47 g/mol. Its IUPAC name is N'-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(2,5-dimethylphenyl)butanediamide.
| Compound Name | N'-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(2,5-dimethylphenyl)butanediamide |
|---|---|
| PubChem CID | 4006167 |
| Molecular Formula | C28H30BrN3O4 |
| Molecular Weight | 552.47 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | N'-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(2,5-dimethylphenyl)butanediamide |
| SMILES | CCOc1cc(C=NNC(=O)CCC(=O)Nc2cc(C)ccc2C)ccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C28H30BrN3O4/c1-4-35-26-16-22(9-12-25(26)36-18-21-7-10-23(29)11-8-21)17-30-32-28(34)14-13-27(33)31-24-15-19(2)5-6-20(24)3/h5-12,15-17H,4,13-14,18H2,1-3H3,(H,31,33)(H,32,34) |
| InChIKey | NWHRMGBWGHQRFB-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|