C32H37IN4O5 — CID 126158577
N'-[(Z)-[3-ethoxy-5-iodo-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide (PubChem CID 126158577) has the molecular formula C32H37IN4O5 and a molecular weight of 684.57 g/mol. Its IUPAC name is N'-[(Z)-[3-ethoxy-5-iodo-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide.
| Compound Name | N'-[(Z)-[3-ethoxy-5-iodo-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 126158577 |
| Molecular Formula | C32H37IN4O5 |
| Molecular Weight | 684.57 g/mol |
| Exact Mass | 684.18 |
| IUPAC Name | N'-[(Z)-[3-ethoxy-5-iodo-4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]phenyl]methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)NCc2ccc(C(C)C)cc2)cc(I)c1OCC(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C32H37IN4O5/c1-7-41-27-15-24(17-35-37-32(40)31(39)34-16-23-8-10-25(11-9-23)19(2)3)14-26(33)30(27)42-18-28(38)36-29-21(5)12-20(4)13-22(29)6/h8-15,17,19H,7,16,18H2,1-6H3,(H,34,39)(H,36,38)(H,37,40)/b35-17- |
| InChIKey | ARYTYJZXVKUCPM-QMRORBIVSA-N |
| XLogP | 5.52 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.57 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|