C30H32BrClN4O5 — CID 126156371
N'-[(Z)-[3-bromo-4-[2-(3-chloro-2-methylanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide (PubChem CID 126156371) has the molecular formula C30H32BrClN4O5 and a molecular weight of 643.97 g/mol. Its IUPAC name is N'-[(Z)-[3-bromo-4-[2-(3-chloro-2-methylanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide.
| Compound Name | N'-[(Z)-[3-bromo-4-[2-(3-chloro-2-methylanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 126156371 |
| Molecular Formula | C30H32BrClN4O5 |
| Molecular Weight | 643.97 g/mol |
| Exact Mass | 642.12 |
| IUPAC Name | N'-[(Z)-[3-bromo-4-[2-(3-chloro-2-methylanilino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)NCc2ccc(C(C)C)cc2)cc(Br)c1OCC(=O)Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C30H32BrClN4O5/c1-5-40-26-14-21(13-23(31)28(26)41-17-27(37)35-25-8-6-7-24(32)19(25)4)16-34-36-30(39)29(38)33-15-20-9-11-22(12-10-20)18(2)3/h6-14,16,18H,5,15,17H2,1-4H3,(H,33,38)(H,35,37)(H,36,39)/b34-16- |
| InChIKey | ABBYNARLTHNTTC-MJXLXAJKSA-N |
| XLogP | 5.72 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.97 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|