C30H33BrN4O5 — CID 126170241
N'-[(Z)-[4-[2-(4-bromo-3-methylanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide (PubChem CID 126170241) has the molecular formula C30H33BrN4O5 and a molecular weight of 609.52 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(4-bromo-3-methylanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide.
| Compound Name | N'-[(Z)-[4-[2-(4-bromo-3-methylanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 126170241 |
| Molecular Formula | C30H33BrN4O5 |
| Molecular Weight | 609.52 g/mol |
| Exact Mass | 608.16 |
| IUPAC Name | N'-[(Z)-[4-[2-(4-bromo-3-methylanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)NCc2ccc(C(C)C)cc2)ccc1OCC(=O)Nc1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C30H33BrN4O5/c1-5-39-27-15-22(8-13-26(27)40-18-28(36)34-24-11-12-25(31)20(4)14-24)17-33-35-30(38)29(37)32-16-21-6-9-23(10-7-21)19(2)3/h6-15,17,19H,5,16,18H2,1-4H3,(H,32,37)(H,34,36)(H,35,38)/b33-17- |
| InChIKey | AILOGPUTSZXYHM-FZPRHHONSA-N |
| XLogP | 5.06 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|