C21H24ClN3O3 — CID 8931669
N'-[(Z)-(3-chloro-4-ethoxyphenyl)methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide (PubChem CID 8931669) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is N'-[(Z)-(3-chloro-4-ethoxyphenyl)methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide.
| Compound Name | N'-[(Z)-(3-chloro-4-ethoxyphenyl)methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 8931669 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N'-[(Z)-(3-chloro-4-ethoxyphenyl)methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide |
| SMILES | CCOc1ccc(/C=N\NC(=O)C(=O)NCc2ccc(C(C)C)cc2)cc1Cl |
| InChI | InChI=1S/C21H24ClN3O3/c1-4-28-19-10-7-16(11-18(19)22)13-24-25-21(27)20(26)23-12-15-5-8-17(9-6-15)14(2)3/h5-11,13-14H,4,12H2,1-3H3,(H,23,26)(H,25,27)/b24-13- |
| InChIKey | ILZPFQZOPHRVOH-CFRMEGHHSA-N |
| XLogP | 3.63 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|