C28H28BrClN4O5 — CID 126178778
N'-[(Z)-[3-bromo-4-[2-(4-chloroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide (PubChem CID 126178778) has the molecular formula C28H28BrClN4O5 and a molecular weight of 615.91 g/mol. Its IUPAC name is N'-[(Z)-[3-bromo-4-[2-(4-chloroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide.
| Compound Name | N'-[(Z)-[3-bromo-4-[2-(4-chloroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 126178778 |
| Molecular Formula | C28H28BrClN4O5 |
| Molecular Weight | 615.91 g/mol |
| Exact Mass | 614.09 |
| IUPAC Name | N'-[(Z)-[3-bromo-4-[2-(4-chloroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)NCc2ccc(C(C)C)cc2)cc(Br)c1OCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H28BrClN4O5/c1-17(2)20-6-4-18(5-7-20)14-31-27(36)28(37)34-32-15-19-12-23(29)26(24(13-19)38-3)39-16-25(35)33-22-10-8-21(30)9-11-22/h4-13,15,17H,14,16H2,1-3H3,(H,31,36)(H,33,35)(H,34,37)/b32-15- |
| InChIKey | JMPMJQLBAXYHGB-CNCDYAKUSA-N |
| XLogP | 5.02 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.91 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|