C25H21BrCl2N4O5 — CID 6024584
N-benzyl-N'-[(Z)-[3-bromo-4-[2-(3,5-dichloroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]oxamide (PubChem CID 6024584) has the molecular formula C25H21BrCl2N4O5 and a molecular weight of 608.28 g/mol. Its IUPAC name is N-benzyl-N'-[(Z)-[3-bromo-4-[2-(3,5-dichloroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]oxamide.
| Compound Name | N-benzyl-N'-[(Z)-[3-bromo-4-[2-(3,5-dichloroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 6024584 |
| Molecular Formula | C25H21BrCl2N4O5 |
| Molecular Weight | 608.28 g/mol |
| Exact Mass | 606.01 |
| IUPAC Name | N-benzyl-N'-[(Z)-[3-bromo-4-[2-(3,5-dichloroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)NCc2ccccc2)cc(Br)c1OCC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C25H21BrCl2N4O5/c1-36-21-8-16(13-30-32-25(35)24(34)29-12-15-5-3-2-4-6-15)7-20(26)23(21)37-14-22(33)31-19-10-17(27)9-18(28)11-19/h2-11,13H,12,14H2,1H3,(H,29,34)(H,31,33)(H,32,35)/b30-13- |
| InChIKey | ZQGRUDQVAURUIC-YNFMAFFXSA-N |
| XLogP | 4.55 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.28 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|