C24H29IN4O5 — CID 126179122
N-[(2S)-butan-2-yl]-N'-[(Z)-[4-[2-(3,4-dimethylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]oxamide (PubChem CID 126179122) has the molecular formula C24H29IN4O5 and a molecular weight of 580.42 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-N'-[(Z)-[4-[2-(3,4-dimethylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]oxamide.
| Compound Name | N-[(2S)-butan-2-yl]-N'-[(Z)-[4-[2-(3,4-dimethylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126179122 |
| Molecular Formula | C24H29IN4O5 |
| Molecular Weight | 580.42 g/mol |
| Exact Mass | 580.12 |
| IUPAC Name | N-[(2S)-butan-2-yl]-N'-[(Z)-[4-[2-(3,4-dimethylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]oxamide |
| SMILES | CC[C@H](C)NC(=O)C(=O)N/N=C\c1cc(I)c(OCC(=O)Nc2ccc(C)c(C)c2)c(OC)c1 |
| InChI | InChI=1S/C24H29IN4O5/c1-6-16(4)27-23(31)24(32)29-26-12-17-10-19(25)22(20(11-17)33-5)34-13-21(30)28-18-8-7-14(2)15(3)9-18/h7-12,16H,6,13H2,1-5H3,(H,27,31)(H,28,30)(H,29,32)/b26-12-/t16-/m0/s1 |
| InChIKey | GASJJCUXMUYKNH-DEDQRJBRSA-N |
| XLogP | 3.30 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|