C23H27IN4O5 — CID 126176715
N-[(2R)-butan-2-yl]-N'-[(Z)-[3-iodo-5-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide (PubChem CID 126176715) has the molecular formula C23H27IN4O5 and a molecular weight of 566.40 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-N'-[(Z)-[3-iodo-5-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-[(2R)-butan-2-yl]-N'-[(Z)-[3-iodo-5-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126176715 |
| Molecular Formula | C23H27IN4O5 |
| Molecular Weight | 566.40 g/mol |
| Exact Mass | 566.10 |
| IUPAC Name | N-[(2R)-butan-2-yl]-N'-[(Z)-[3-iodo-5-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
| SMILES | CC[C@@H](C)NC(=O)C(=O)N/N=C\c1cc(I)c(OCC(=O)Nc2ccccc2C)c(OC)c1 |
| InChI | InChI=1S/C23H27IN4O5/c1-5-15(3)26-22(30)23(31)28-25-12-16-10-17(24)21(19(11-16)32-4)33-13-20(29)27-18-9-7-6-8-14(18)2/h6-12,15H,5,13H2,1-4H3,(H,26,30)(H,27,29)(H,28,31)/b25-12-/t15-/m1/s1 |
| InChIKey | VRARIODAXYRLCQ-WWPWHYENSA-N |
| XLogP | 2.99 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|