C28H29IN4O6 — CID 126162147
N'-[(Z)-[3-iodo-5-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-propoxyphenyl)oxamide (PubChem CID 126162147) has the molecular formula C28H29IN4O6 and a molecular weight of 644.47 g/mol. Its IUPAC name is N'-[(Z)-[3-iodo-5-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-propoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[3-iodo-5-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-propoxyphenyl)oxamide |
|---|---|
| PubChem CID | 126162147 |
| Molecular Formula | C28H29IN4O6 |
| Molecular Weight | 644.47 g/mol |
| Exact Mass | 644.11 |
| IUPAC Name | N'-[(Z)-[3-iodo-5-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-propoxyphenyl)oxamide |
| SMILES | CCCOc1ccc(NC(=O)C(=O)N/N=C\c2cc(I)c(OCC(=O)Nc3ccccc3C)c(OC)c2)cc1 |
| InChI | InChI=1S/C28H29IN4O6/c1-4-13-38-21-11-9-20(10-12-21)31-27(35)28(36)33-30-16-19-14-22(29)26(24(15-19)37-3)39-17-25(34)32-23-8-6-5-7-18(23)2/h5-12,14-16H,4,13,17H2,1-3H3,(H,31,35)(H,32,34)(H,33,36)/b30-16- |
| InChIKey | REXWOGZIOAIAEM-UHBFCERESA-N |
| XLogP | 4.50 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|