C29H29IN4O6 — CID 126157653
N'-[(Z)-[4-[2-(3,5-dimethylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide (PubChem CID 126157653) has the molecular formula C29H29IN4O6 and a molecular weight of 656.48 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(3,5-dimethylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[4-[2-(3,5-dimethylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide |
|---|---|
| PubChem CID | 126157653 |
| Molecular Formula | C29H29IN4O6 |
| Molecular Weight | 656.48 g/mol |
| Exact Mass | 656.11 |
| IUPAC Name | N'-[(Z)-[4-[2-(3,5-dimethylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide |
| SMILES | C=CCOc1ccc(NC(=O)C(=O)N/N=C\c2cc(I)c(OCC(=O)Nc3cc(C)cc(C)c3)c(OC)c2)cc1 |
| InChI | InChI=1S/C29H29IN4O6/c1-5-10-39-23-8-6-21(7-9-23)33-28(36)29(37)34-31-16-20-14-24(30)27(25(15-20)38-4)40-17-26(35)32-22-12-18(2)11-19(3)13-22/h5-9,11-16H,1,10,17H2,2-4H3,(H,32,35)(H,33,36)(H,34,37)/b31-16- |
| InChIKey | GIUVMLKUNJDHPJ-ACXHZZMFSA-N |
| XLogP | 4.59 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|