C30H31IN4O6 — CID 126163495
N'-[(Z)-[3-ethoxy-4-[2-(4-ethylanilino)-2-oxoethoxy]-5-iodophenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide (PubChem CID 126163495) has the molecular formula C30H31IN4O6 and a molecular weight of 670.50 g/mol. Its IUPAC name is N'-[(Z)-[3-ethoxy-4-[2-(4-ethylanilino)-2-oxoethoxy]-5-iodophenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[3-ethoxy-4-[2-(4-ethylanilino)-2-oxoethoxy]-5-iodophenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide |
|---|---|
| PubChem CID | 126163495 |
| Molecular Formula | C30H31IN4O6 |
| Molecular Weight | 670.50 g/mol |
| Exact Mass | 670.13 |
| IUPAC Name | N'-[(Z)-[3-ethoxy-4-[2-(4-ethylanilino)-2-oxoethoxy]-5-iodophenyl]methylideneamino]-N-(4-prop-2-enoxyphenyl)oxamide |
| SMILES | C=CCOc1ccc(NC(=O)C(=O)N/N=C\c2cc(I)c(OCC(=O)Nc3ccc(CC)cc3)c(OCC)c2)cc1 |
| InChI | InChI=1S/C30H31IN4O6/c1-4-15-40-24-13-11-23(12-14-24)34-29(37)30(38)35-32-18-21-16-25(31)28(26(17-21)39-6-3)41-19-27(36)33-22-9-7-20(5-2)8-10-22/h4,7-14,16-18H,1,5-6,15,19H2,2-3H3,(H,33,36)(H,34,37)(H,35,38)/b32-18- |
| InChIKey | IAPXVDURCFRIOT-CAQPMQTCSA-N |
| XLogP | 4.92 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|