C26H23Cl2IN4O6 — CID 126173651
N-(2,3-dichlorophenyl)-N'-[(Z)-[3-ethoxy-5-iodo-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide (PubChem CID 126173651) has the molecular formula C26H23Cl2IN4O6 and a molecular weight of 685.30 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-N'-[(Z)-[3-ethoxy-5-iodo-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-(2,3-dichlorophenyl)-N'-[(Z)-[3-ethoxy-5-iodo-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126173651 |
| Molecular Formula | C26H23Cl2IN4O6 |
| Molecular Weight | 685.30 g/mol |
| Exact Mass | 684.00 |
| IUPAC Name | N-(2,3-dichlorophenyl)-N'-[(Z)-[3-ethoxy-5-iodo-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)Nc2cccc(Cl)c2Cl)cc(I)c1OCC(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H23Cl2IN4O6/c1-3-38-21-12-15(13-30-33-26(36)25(35)32-20-6-4-5-18(27)23(20)28)11-19(29)24(21)39-14-22(34)31-16-7-9-17(37-2)10-8-16/h4-13H,3,14H2,1-2H3,(H,31,34)(H,32,35)(H,33,36)/b30-13- |
| InChIKey | IOEGBGSJPYBLJK-YNFMAFFXSA-N |
| XLogP | 5.11 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.30 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|