C19H18Cl2IN3O4 — CID 3909098
N-(2,3-dichlorophenyl)-N'-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylideneamino]propanediamide (PubChem CID 3909098) has the molecular formula C19H18Cl2IN3O4 and a molecular weight of 550.18 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-N'-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylideneamino]propanediamide.
| Compound Name | N-(2,3-dichlorophenyl)-N'-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 3909098 |
| Molecular Formula | C19H18Cl2IN3O4 |
| Molecular Weight | 550.18 g/mol |
| Exact Mass | 548.97 |
| IUPAC Name | N-(2,3-dichlorophenyl)-N'-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylideneamino]propanediamide |
| SMILES | CCOc1cc(C=NNC(=O)CC(=O)Nc2cccc(Cl)c2Cl)cc(I)c1OC |
| InChI | InChI=1S/C19H18Cl2IN3O4/c1-3-29-15-8-11(7-13(22)19(15)28-2)10-23-25-17(27)9-16(26)24-14-6-4-5-12(20)18(14)21/h4-8,10H,3,9H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | CNVLTYXESPYSLC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.18 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|