C21H21Cl2N3O6 — CID 3946821
ethyl 2-[4-[[[3-(2,3-dichloroanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 3946821) has the molecular formula C21H21Cl2N3O6 and a molecular weight of 482.32 g/mol. Its IUPAC name is ethyl 2-[4-[[[3-(2,3-dichloroanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[[[3-(2,3-dichloroanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 3946821 |
| Molecular Formula | C21H21Cl2N3O6 |
| Molecular Weight | 482.32 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | ethyl 2-[4-[[[3-(2,3-dichloroanilino)-3-oxopropanoyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C=NNC(=O)CC(=O)Nc2cccc(Cl)c2Cl)cc1OC |
| InChI | InChI=1S/C21H21Cl2N3O6/c1-3-31-20(29)12-32-16-8-7-13(9-17(16)30-2)11-24-26-19(28)10-18(27)25-15-6-4-5-14(22)21(15)23/h4-9,11H,3,10,12H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | WGKYNGZETPHLIF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|