C17H16Cl2N4O4 — CID 110341281
2-[4-[(E)-(carbamoylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-(2,3-dichlorophenyl)acetamide (PubChem CID 110341281) has the molecular formula C17H16Cl2N4O4 and a molecular weight of 411.25 g/mol. Its IUPAC name is 2-[4-[(E)-(carbamoylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-(2,3-dichlorophenyl)acetamide.
| Compound Name | 2-[4-[(E)-(carbamoylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-(2,3-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 110341281 |
| Molecular Formula | C17H16Cl2N4O4 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 2-[4-[(E)-(carbamoylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-(2,3-dichlorophenyl)acetamide |
| SMILES | COc1cc(/C=N/NC(N)=O)ccc1OCC(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H16Cl2N4O4/c1-26-14-7-10(8-21-23-17(20)25)5-6-13(14)27-9-15(24)22-12-4-2-3-11(18)16(12)19/h2-8H,9H2,1H3,(H,22,24)(H3,20,23,25)/b21-8+ |
| InChIKey | RJSXACBUDCEDHA-ODCIPOBUSA-N |
| XLogP | 3.02 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|