C23H17Cl4N3O4 — CID 124540731
N-(2,3-dichlorophenyl)-N'-[(Z)-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]oxamide (PubChem CID 124540731) has the molecular formula C23H17Cl4N3O4 and a molecular weight of 541.22 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-N'-[(Z)-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]oxamide.
| Compound Name | N-(2,3-dichlorophenyl)-N'-[(Z)-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 124540731 |
| Molecular Formula | C23H17Cl4N3O4 |
| Molecular Weight | 541.22 g/mol |
| Exact Mass | 539.00 |
| IUPAC Name | N-(2,3-dichlorophenyl)-N'-[(Z)-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)Nc2cccc(Cl)c2Cl)ccc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H17Cl4N3O4/c1-33-20-10-13(8-9-19(20)34-12-14-15(24)4-2-5-16(14)25)11-28-30-23(32)22(31)29-18-7-3-6-17(26)21(18)27/h2-11H,12H2,1H3,(H,29,31)(H,30,32)/b28-11- |
| InChIKey | YEGHVFYCNLHIOO-FXMZOFOKSA-N |
| XLogP | 5.98 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.22 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|