C27H25Cl2N3O6 — CID 3727933
[4-[[[2-(2,3-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-butoxybenzoate (PubChem CID 3727933) has the molecular formula C27H25Cl2N3O6 and a molecular weight of 558.42 g/mol. Its IUPAC name is [4-[[[2-(2,3-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-butoxybenzoate.
| Compound Name | [4-[[[2-(2,3-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 3727933 |
| Molecular Formula | C27H25Cl2N3O6 |
| Molecular Weight | 558.42 g/mol |
| Exact Mass | 557.11 |
| IUPAC Name | [4-[[[2-(2,3-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(C=NNC(=O)C(=O)Nc3cccc(Cl)c3Cl)cc2OC)cc1 |
| InChI | InChI=1S/C27H25Cl2N3O6/c1-3-4-14-37-19-11-9-18(10-12-19)27(35)38-22-13-8-17(15-23(22)36-2)16-30-32-26(34)25(33)31-21-7-5-6-20(28)24(21)29/h5-13,15-16H,3-4,14H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | HKULSAPFJGWCMP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|