C26H23Cl2N3O6 — CID 6034808
[4-[(Z)-[[2-(2,5-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-propoxybenzoate (PubChem CID 6034808) has the molecular formula C26H23Cl2N3O6 and a molecular weight of 544.39 g/mol. Its IUPAC name is [4-[(Z)-[[2-(2,5-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-propoxybenzoate.
| Compound Name | [4-[(Z)-[[2-(2,5-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-propoxybenzoate |
|---|---|
| PubChem CID | 6034808 |
| Molecular Formula | C26H23Cl2N3O6 |
| Molecular Weight | 544.39 g/mol |
| Exact Mass | 543.10 |
| IUPAC Name | [4-[(Z)-[[2-(2,5-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)Oc2ccc(/C=N\NC(=O)C(=O)Nc3cc(Cl)ccc3Cl)cc2OC)cc1 |
| InChI | InChI=1S/C26H23Cl2N3O6/c1-3-12-36-19-8-5-17(6-9-19)26(34)37-22-11-4-16(13-23(22)35-2)15-29-31-25(33)24(32)30-21-14-18(27)7-10-20(21)28/h4-11,13-15H,3,12H2,1-2H3,(H,30,32)(H,31,33)/b29-15- |
| InChIKey | VJKVJTISGYDKHR-FDVSRXAVSA-N |
| XLogP | 5.10 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.39 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|