C24H23ClN2O6S — CID 3457911
[4-[[(4-chlorophenyl)sulfonylhydrazinylidene]methyl]-2-methoxyphenyl] 4-propoxybenzoate (PubChem CID 3457911) has the molecular formula C24H23ClN2O6S and a molecular weight of 502.98 g/mol. Its IUPAC name is [4-[[(4-chlorophenyl)sulfonylhydrazinylidene]methyl]-2-methoxyphenyl] 4-propoxybenzoate.
| Compound Name | [4-[[(4-chlorophenyl)sulfonylhydrazinylidene]methyl]-2-methoxyphenyl] 4-propoxybenzoate |
|---|---|
| PubChem CID | 3457911 |
| Molecular Formula | C24H23ClN2O6S |
| Molecular Weight | 502.98 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | [4-[[(4-chlorophenyl)sulfonylhydrazinylidene]methyl]-2-methoxyphenyl] 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)Oc2ccc(C=NNS(=O)(=O)c3ccc(Cl)cc3)cc2OC)cc1 |
| InChI | InChI=1S/C24H23ClN2O6S/c1-3-14-32-20-9-5-18(6-10-20)24(28)33-22-13-4-17(15-23(22)31-2)16-26-27-34(29,30)21-11-7-19(25)8-12-21/h4-13,15-16,27H,3,14H2,1-2H3 |
| InChIKey | YTMSDZYRWROLTL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.98 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|