C21H16BrClN2O5S — CID 6008417
[4-[(Z)-[(4-chlorophenyl)sulfonylhydrazinylidene]methyl]-2-methoxyphenyl] 3-bromobenzoate (PubChem CID 6008417) has the molecular formula C21H16BrClN2O5S and a molecular weight of 523.79 g/mol. Its IUPAC name is [4-[(Z)-[(4-chlorophenyl)sulfonylhydrazinylidene]methyl]-2-methoxyphenyl] 3-bromobenzoate.
| Compound Name | [4-[(Z)-[(4-chlorophenyl)sulfonylhydrazinylidene]methyl]-2-methoxyphenyl] 3-bromobenzoate |
|---|---|
| PubChem CID | 6008417 |
| Molecular Formula | C21H16BrClN2O5S |
| Molecular Weight | 523.79 g/mol |
| Exact Mass | 521.97 |
| IUPAC Name | [4-[(Z)-[(4-chlorophenyl)sulfonylhydrazinylidene]methyl]-2-methoxyphenyl] 3-bromobenzoate |
| SMILES | COc1cc(/C=N\NS(=O)(=O)c2ccc(Cl)cc2)ccc1OC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C21H16BrClN2O5S/c1-29-20-11-14(13-24-25-31(27,28)18-8-6-17(23)7-9-18)5-10-19(20)30-21(26)15-3-2-4-16(22)12-15/h2-13,25H,1H3/b24-13- |
| InChIKey | NWLGEMXVZZLIFP-CFRMEGHHSA-N |
| XLogP | 4.64 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.79 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|