C24H22BrN3O6S — CID 6246130
[2-methoxy-4-[(Z)-[[2-[(4-methylphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]phenyl] 3-bromobenzoate (PubChem CID 6246130) has the molecular formula C24H22BrN3O6S and a molecular weight of 560.43 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-[[2-[(4-methylphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]phenyl] 3-bromobenzoate.
| Compound Name | [2-methoxy-4-[(Z)-[[2-[(4-methylphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]phenyl] 3-bromobenzoate |
|---|---|
| PubChem CID | 6246130 |
| Molecular Formula | C24H22BrN3O6S |
| Molecular Weight | 560.43 g/mol |
| Exact Mass | 559.04 |
| IUPAC Name | [2-methoxy-4-[(Z)-[[2-[(4-methylphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]phenyl] 3-bromobenzoate |
| SMILES | COc1cc(/C=N\NC(=O)CNS(=O)(=O)c2ccc(C)cc2)ccc1OC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C24H22BrN3O6S/c1-16-6-9-20(10-7-16)35(31,32)27-15-23(29)28-26-14-17-8-11-21(22(12-17)33-2)34-24(30)18-4-3-5-19(25)13-18/h3-14,27H,15H2,1-2H3,(H,28,29)/b26-14- |
| InChIKey | POUKMIWLFRSPHZ-WGARJPEWSA-N |
| XLogP | 3.41 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|