C28H22BrN3O6S — CID 3868833
[4-[[[4-(benzenesulfonamido)benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-bromobenzoate (PubChem CID 3868833) has the molecular formula C28H22BrN3O6S and a molecular weight of 608.47 g/mol. Its IUPAC name is [4-[[[4-(benzenesulfonamido)benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-bromobenzoate.
| Compound Name | [4-[[[4-(benzenesulfonamido)benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-bromobenzoate |
|---|---|
| PubChem CID | 3868833 |
| Molecular Formula | C28H22BrN3O6S |
| Molecular Weight | 608.47 g/mol |
| Exact Mass | 607.04 |
| IUPAC Name | [4-[[[4-(benzenesulfonamido)benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-bromobenzoate |
| SMILES | COc1cc(C=NNC(=O)c2ccc(NS(=O)(=O)c3ccccc3)cc2)ccc1OC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C28H22BrN3O6S/c1-37-26-16-19(10-15-25(26)38-28(34)21-6-5-7-22(29)17-21)18-30-31-27(33)20-11-13-23(14-12-20)32-39(35,36)24-8-3-2-4-9-24/h2-18,32H,1H3,(H,31,33) |
| InChIKey | FHZDNVLUUKPWNZ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|