C28H20Cl3N3O6S — CID 4057032
[4-[[[4-[(4-chlorophenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3,4-dichlorobenzoate (PubChem CID 4057032) has the molecular formula C28H20Cl3N3O6S and a molecular weight of 632.91 g/mol. Its IUPAC name is [4-[[[4-[(4-chlorophenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3,4-dichlorobenzoate.
| Compound Name | [4-[[[4-[(4-chlorophenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 4057032 |
| Molecular Formula | C28H20Cl3N3O6S |
| Molecular Weight | 632.91 g/mol |
| Exact Mass | 631.01 |
| IUPAC Name | [4-[[[4-[(4-chlorophenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3,4-dichlorobenzoate |
| SMILES | COc1cc(C=NNC(=O)c2ccc(NS(=O)(=O)c3ccc(Cl)cc3)cc2)ccc1OC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H20Cl3N3O6S/c1-39-26-14-17(2-13-25(26)40-28(36)19-5-12-23(30)24(31)15-19)16-32-33-27(35)18-3-8-21(9-4-18)34-41(37,38)22-10-6-20(29)7-11-22/h2-16,34H,1H3,(H,33,35) |
| InChIKey | AUCAPQWZKJZNSY-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.91 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|