C22H20ClN3O5S — CID 4586395
4-[(4-chlorophenyl)sulfonylamino]-N-[(3,4-dimethoxyphenyl)methylideneamino]benzamide (PubChem CID 4586395) has the molecular formula C22H20ClN3O5S and a molecular weight of 473.94 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)sulfonylamino]-N-[(3,4-dimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-[(4-chlorophenyl)sulfonylamino]-N-[(3,4-dimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 4586395 |
| Molecular Formula | C22H20ClN3O5S |
| Molecular Weight | 473.94 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 4-[(4-chlorophenyl)sulfonylamino]-N-[(3,4-dimethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc(C=NNC(=O)c2ccc(NS(=O)(=O)c3ccc(Cl)cc3)cc2)cc1OC |
| InChI | InChI=1S/C22H20ClN3O5S/c1-30-20-12-3-15(13-21(20)31-2)14-24-25-22(27)16-4-8-18(9-5-16)26-32(28,29)19-10-6-17(23)7-11-19/h3-14,26H,1-2H3,(H,25,27) |
| InChIKey | DOUKXAAAPLSLBK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.94 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|