C20H15Cl2N3O3S — CID 51060542
N-[(E)-(3-chlorophenyl)methylideneamino]-4-[(4-chlorophenyl)sulfonylamino]benzamide (PubChem CID 51060542) has the molecular formula C20H15Cl2N3O3S and a molecular weight of 448.33 g/mol. Its IUPAC name is N-[(E)-(3-chlorophenyl)methylideneamino]-4-[(4-chlorophenyl)sulfonylamino]benzamide.
| Compound Name | N-[(E)-(3-chlorophenyl)methylideneamino]-4-[(4-chlorophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 51060542 |
| Molecular Formula | C20H15Cl2N3O3S |
| Molecular Weight | 448.33 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | N-[(E)-(3-chlorophenyl)methylideneamino]-4-[(4-chlorophenyl)sulfonylamino]benzamide |
| SMILES | O=C(N/N=C/c1cccc(Cl)c1)c1ccc(NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H15Cl2N3O3S/c21-16-6-10-19(11-7-16)29(27,28)25-18-8-4-15(5-9-18)20(26)24-23-13-14-2-1-3-17(22)12-14/h1-13,25H,(H,24,26)/b23-13+ |
| InChIKey | BGLYFIWBPRYJHO-YDZHTSKRSA-N |
| XLogP | 4.56 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|