C20H15BrClN3O4S — CID 136782247
N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-4-[(4-chlorophenyl)sulfonylamino]benzamide (PubChem CID 136782247) has the molecular formula C20H15BrClN3O4S and a molecular weight of 508.78 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-4-[(4-chlorophenyl)sulfonylamino]benzamide.
| Compound Name | N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-4-[(4-chlorophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 136782247 |
| Molecular Formula | C20H15BrClN3O4S |
| Molecular Weight | 508.78 g/mol |
| Exact Mass | 506.97 |
| IUPAC Name | N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]-4-[(4-chlorophenyl)sulfonylamino]benzamide |
| SMILES | O=C(N/N=C\c1cc(Br)ccc1O)c1ccc(NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H15BrClN3O4S/c21-15-3-10-19(26)14(11-15)12-23-24-20(27)13-1-6-17(7-2-13)25-30(28,29)18-8-4-16(22)5-9-18/h1-12,25-26H,(H,24,27)/b23-12- |
| InChIKey | OSFWAQVFLONFQZ-FMCGGJTJSA-N |
| XLogP | 4.37 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.78 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|