C29H24ClN3O6S — CID 6036795
[4-[(Z)-[[4-[(4-chlorophenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]-2-ethoxyphenyl] benzoate (PubChem CID 6036795) has the molecular formula C29H24ClN3O6S and a molecular weight of 578.05 g/mol. Its IUPAC name is [4-[(Z)-[[4-[(4-chlorophenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]-2-ethoxyphenyl] benzoate.
| Compound Name | [4-[(Z)-[[4-[(4-chlorophenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]-2-ethoxyphenyl] benzoate |
|---|---|
| PubChem CID | 6036795 |
| Molecular Formula | C29H24ClN3O6S |
| Molecular Weight | 578.05 g/mol |
| Exact Mass | 577.11 |
| IUPAC Name | [4-[(Z)-[[4-[(4-chlorophenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]-2-ethoxyphenyl] benzoate |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccc(NS(=O)(=O)c3ccc(Cl)cc3)cc2)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H24ClN3O6S/c1-2-38-27-18-20(8-17-26(27)39-29(35)22-6-4-3-5-7-22)19-31-32-28(34)21-9-13-24(14-10-21)33-40(36,37)25-15-11-23(30)12-16-25/h3-19,33H,2H2,1H3,(H,32,34)/b31-19- |
| InChIKey | DYWFUFNRGHRNPE-DXJNIWACSA-N |
| XLogP | 5.52 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.05 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|