C30H27N3O6S — CID 4218556
[2-ethoxy-4-[[[4-[(4-methylphenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 4218556) has the molecular formula C30H27N3O6S and a molecular weight of 557.63 g/mol. Its IUPAC name is [2-ethoxy-4-[[[4-[(4-methylphenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [2-ethoxy-4-[[[4-[(4-methylphenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 4218556 |
| Molecular Formula | C30H27N3O6S |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | [2-ethoxy-4-[[[4-[(4-methylphenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | CCOc1cc(C=NNC(=O)c2ccc(NS(=O)(=O)c3ccc(C)cc3)cc2)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H27N3O6S/c1-3-38-28-19-22(11-18-27(28)39-30(35)24-7-5-4-6-8-24)20-31-32-29(34)23-12-14-25(15-13-23)33-40(36,37)26-16-9-21(2)10-17-26/h4-20,33H,3H2,1-2H3,(H,32,34) |
| InChIKey | FJROWAWJQBRURB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|