C18H14ClN3O3S2 — CID 18206532
N-[(E)-(4-chlorophenyl)methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 18206532) has the molecular formula C18H14ClN3O3S2 and a molecular weight of 419.92 g/mol. Its IUPAC name is N-[(E)-(4-chlorophenyl)methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(E)-(4-chlorophenyl)methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 18206532 |
| Molecular Formula | C18H14ClN3O3S2 |
| Molecular Weight | 419.92 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | N-[(E)-(4-chlorophenyl)methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(N/N=C/c1ccc(Cl)cc1)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H14ClN3O3S2/c19-15-7-3-13(4-8-15)12-20-21-18(23)14-5-9-16(10-6-14)22-27(24,25)17-2-1-11-26-17/h1-12,22H,(H,21,23)/b20-12+ |
| InChIKey | HEVYAHZBSYGPOX-UDWIEESQSA-N |
| XLogP | 3.97 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.92 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|