C18H14N4O5S2 — CID 2370561
N-[(4-nitrophenyl)methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 2370561) has the molecular formula C18H14N4O5S2 and a molecular weight of 430.47 g/mol. Its IUPAC name is N-[(4-nitrophenyl)methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(4-nitrophenyl)methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 2370561 |
| Molecular Formula | C18H14N4O5S2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | N-[(4-nitrophenyl)methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(NN=Cc1ccc([N+](=O)[O-])cc1)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H14N4O5S2/c23-18(20-19-12-13-3-9-16(10-4-13)22(24)25)14-5-7-15(8-6-14)21-29(26,27)17-2-1-11-28-17/h1-12,21H,(H,20,23) |
| InChIKey | RCXLSKYPLARRFM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 130.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|