C19H16N4O5S2 — CID 6047512
N-[(E)-1-(4-nitrophenyl)ethylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 6047512) has the molecular formula C19H16N4O5S2 and a molecular weight of 444.49 g/mol. Its IUPAC name is N-[(E)-1-(4-nitrophenyl)ethylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(E)-1-(4-nitrophenyl)ethylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 6047512 |
| Molecular Formula | C19H16N4O5S2 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | N-[(E)-1-(4-nitrophenyl)ethylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | C/C(=N\NC(=O)c1ccc(NS(=O)(=O)c2cccs2)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H16N4O5S2/c1-13(14-6-10-17(11-7-14)23(25)26)20-21-19(24)15-4-8-16(9-5-15)22-30(27,28)18-3-2-12-29-18/h2-12,22H,1H3,(H,21,24)/b20-13+ |
| InChIKey | AVQFYGYAAANFBV-DEDYPNTBSA-N |
| XLogP | 3.61 |
| TPSA | 130.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|