C19H16BrN3O5S2 — CID 2355874
N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 2355874) has the molecular formula C19H16BrN3O5S2 and a molecular weight of 510.39 g/mol. Its IUPAC name is N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 2355874 |
| Molecular Formula | C19H16BrN3O5S2 |
| Molecular Weight | 510.39 g/mol |
| Exact Mass | 508.97 |
| IUPAC Name | N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | COc1cc(C=NNC(=O)c2ccc(NS(=O)(=O)c3cccs3)cc2)cc(Br)c1O |
| InChI | InChI=1S/C19H16BrN3O5S2/c1-28-16-10-12(9-15(20)18(16)24)11-21-22-19(25)13-4-6-14(7-5-13)23-30(26,27)17-3-2-8-29-17/h2-11,23-24H,1H3,(H,22,25) |
| InChIKey | QQPZTSSLQBOCHT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|