C18H15N3O4S2 — CID 135745545
N-[(E)-(4-hydroxyphenyl)methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 135745545) has the molecular formula C18H15N3O4S2 and a molecular weight of 401.47 g/mol. Its IUPAC name is N-[(E)-(4-hydroxyphenyl)methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(E)-(4-hydroxyphenyl)methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 135745545 |
| Molecular Formula | C18H15N3O4S2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | N-[(E)-(4-hydroxyphenyl)methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(N/N=C/c1ccc(O)cc1)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H15N3O4S2/c22-16-9-3-13(4-10-16)12-19-20-18(23)14-5-7-15(8-6-14)21-27(24,25)17-2-1-11-26-17/h1-12,21-22H,(H,20,23)/b19-12+ |
| InChIKey | ZMBKLQBLZKLAED-XDHOZWIPSA-N |
| XLogP | 3.02 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|