C18H19N3O3S2 — CID 7392718
N-[(Z)-[(1S)-cyclohex-3-en-1-yl]methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 7392718) has the molecular formula C18H19N3O3S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is N-[(Z)-[(1S)-cyclohex-3-en-1-yl]methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(Z)-[(1S)-cyclohex-3-en-1-yl]methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 7392718 |
| Molecular Formula | C18H19N3O3S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | N-[(Z)-[(1S)-cyclohex-3-en-1-yl]methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(N/N=C\[C@@H]1CC=CCC1)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H19N3O3S2/c22-18(20-19-13-14-5-2-1-3-6-14)15-8-10-16(11-9-15)21-26(23,24)17-7-4-12-25-17/h1-2,4,7-14,21H,3,5-6H2,(H,20,22)/b19-13-/t14-/m1/s1 |
| InChIKey | NPJZQQHVTFUDAK-RMENWYJGSA-N |
| XLogP | 3.62 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|